C13H15N3O7S — CID 10832159
(2S,3S,4R,5R)-3-azido-5-methoxy-4-(4-methylphenyl)sulfonyloxyoxolane-2-carboxylic acid (PubChem CID 10832159) has the molecular formula C13H15N3O7S and a molecular weight of 357.34 g/mol. Its IUPAC name is (2S,3S,4R,5R)-3-azido-5-methoxy-4-(4-methylphenyl)sulfonyloxyoxolane-2-carboxylic acid.
| Compound Name | (2S,3S,4R,5R)-3-azido-5-methoxy-4-(4-methylphenyl)sulfonyloxyoxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 10832159 |
| Molecular Formula | C13H15N3O7S |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | (2S,3S,4R,5R)-3-azido-5-methoxy-4-(4-methylphenyl)sulfonyloxyoxolane-2-carboxylic acid |
| SMILES | CO[C@@H]1O[C@H](C(=O)O)[C@H](N=[N+]=[N-])[C@H]1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H15N3O7S/c1-7-3-5-8(6-4-7)24(19,20)23-11-9(15-16-14)10(12(17)18)22-13(11)21-2/h3-6,9-11,13H,1-2H3,(H,17,18)/t9-,10-,11+,13+/m0/s1 |
| InChIKey | PSTFRMFSMYJWMI-MEWQQHAOSA-N |
| XLogP | 1.20 |
| TPSA | 147.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|