C22H38N3O8PSSi — CID 10769270
[(2R,3S,4R,5S)-4-azido-2-[tert-butyl(dimethyl)silyl]oxy-5-(diethoxyphosphorylmethyl)oxolan-3-yl] 4-methylbenzenesulfonate (PubChem CID 10769270) has the molecular formula C22H38N3O8PSSi and a molecular weight of 563.69 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-4-azido-2-[tert-butyl(dimethyl)silyl]oxy-5-(diethoxyphosphorylmethyl)oxolan-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,3S,4R,5S)-4-azido-2-[tert-butyl(dimethyl)silyl]oxy-5-(diethoxyphosphorylmethyl)oxolan-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10769270 |
| Molecular Formula | C22H38N3O8PSSi |
| Molecular Weight | 563.69 g/mol |
| Exact Mass | 563.19 |
| IUPAC Name | [(2R,3S,4R,5S)-4-azido-2-[tert-butyl(dimethyl)silyl]oxy-5-(diethoxyphosphorylmethyl)oxolan-3-yl] 4-methylbenzenesulfonate |
| SMILES | CCOP(=O)(C[C@H]1O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](OS(=O)(=O)c2ccc(C)cc2)[C@@H]1N=[N+]=[N-])OCC |
| InChI | InChI=1S/C22H38N3O8PSSi/c1-9-29-34(26,30-10-2)15-18-19(24-25-23)20(21(31-18)33-36(7,8)22(4,5)6)32-35(27,28)17-13-11-16(3)12-14-17/h11-14,18-21H,9-10,15H2,1-8H3/t18-,19-,20+,21-/m1/s1 |
| InChIKey | RGUGXZJABGQQMP-MXEMCNAFSA-N |
| XLogP | 5.76 |
| TPSA | 146.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.69 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|