C9H13N3O3 — CID 89316050
(2S,3R,5R)-4-azido-2-[(E)-prop-1-enyl]-6,8-dioxabicyclo[3.2.1]octan-3-ol (PubChem CID 89316050) has the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. Its IUPAC name is (2S,3R,5R)-4-azido-2-[(E)-prop-1-enyl]-6,8-dioxabicyclo[3.2.1]octan-3-ol.
| Compound Name | (2S,3R,5R)-4-azido-2-[(E)-prop-1-enyl]-6,8-dioxabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 89316050 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | (2S,3R,5R)-4-azido-2-[(E)-prop-1-enyl]-6,8-dioxabicyclo[3.2.1]octan-3-ol |
| SMILES | C/C=C/[C@@H]1C2CO[C@H](O2)C(N=[N+]=[N-])[C@@H]1O |
| InChI | InChI=1S/C9H13N3O3/c1-2-3-5-6-4-14-9(15-6)7(8(5)13)11-12-10/h2-3,5-9,13H,4H2,1H3/b3-2+/t5-,6?,7?,8-,9-/m1/s1 |
| InChIKey | MPMUZCNAOJSYTL-PLEJHJHZSA-N |
| XLogP | 0.97 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|