C15H15Cl3N4O2 — CID 10644074
[(1S,5R,6S)-5-azido-6-phenylmethoxycyclohex-2-en-1-yl] 2,2,2-trichloroethanimidate (PubChem CID 10644074) has the molecular formula C15H15Cl3N4O2 and a molecular weight of 389.67 g/mol. Its IUPAC name is [(1S,5R,6S)-5-azido-6-phenylmethoxycyclohex-2-en-1-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(1S,5R,6S)-5-azido-6-phenylmethoxycyclohex-2-en-1-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 10644074 |
| Molecular Formula | C15H15Cl3N4O2 |
| Molecular Weight | 389.67 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | [(1S,5R,6S)-5-azido-6-phenylmethoxycyclohex-2-en-1-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/O[C@H]1C=CC[C@@H](N=[N+]=[N-])[C@@H]1OCc1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H15Cl3N4O2/c16-15(17,18)14(19)24-12-8-4-7-11(21-22-20)13(12)23-9-10-5-2-1-3-6-10/h1-6,8,11-13,19H,7,9H2/b19-14+/t11-,12+,13+/m1/s1 |
| InChIKey | WXGZUTQXNXCCLY-XHVFRWCOSA-N |
| XLogP | 4.94 |
| TPSA | 91.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.67 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|