C31H34Cl3NO4 — CID 58059617
[(1R,3S,4S)-3-methyl-2,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)cyclohexyl] 2,2,2-trichloroethanimidate (PubChem CID 58059617) has the molecular formula C31H34Cl3NO4 and a molecular weight of 590.98 g/mol. Its IUPAC name is [(1R,3S,4S)-3-methyl-2,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)cyclohexyl] 2,2,2-trichloroethanimidate.
| Compound Name | [(1R,3S,4S)-3-methyl-2,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)cyclohexyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 58059617 |
| Molecular Formula | C31H34Cl3NO4 |
| Molecular Weight | 590.98 g/mol |
| Exact Mass | 589.16 |
| IUPAC Name | [(1R,3S,4S)-3-methyl-2,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)cyclohexyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/O[C@@H]1CC(COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](C)C1OCc1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C31H34Cl3NO4/c1-22-28(37-19-24-13-7-3-8-14-24)26(21-36-18-23-11-5-2-6-12-23)17-27(39-30(35)31(32,33)34)29(22)38-20-25-15-9-4-10-16-25/h2-16,22,26-29,35H,17-21H2,1H3/b35-30+/t22-,26?,27+,28+,29?/m0/s1 |
| InChIKey | ZPPCMWRZAZSDCJ-YVOPYXGESA-N |
| XLogP | 7.76 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.98 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|