C26H33Cl3NO5P — CID 90429058
[(1S,3S,4S)-5-[bis(phenylmethoxy)phosphoryloxymethyl]-2,3,4-trimethylcyclohexyl] 2,2,2-trichloroethanimidate (PubChem CID 90429058) has the molecular formula C26H33Cl3NO5P and a molecular weight of 576.89 g/mol. Its IUPAC name is [(1S,3S,4S)-5-[bis(phenylmethoxy)phosphoryloxymethyl]-2,3,4-trimethylcyclohexyl] 2,2,2-trichloroethanimidate.
| Compound Name | [(1S,3S,4S)-5-[bis(phenylmethoxy)phosphoryloxymethyl]-2,3,4-trimethylcyclohexyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 90429058 |
| Molecular Formula | C26H33Cl3NO5P |
| Molecular Weight | 576.89 g/mol |
| Exact Mass | 575.12 |
| IUPAC Name | [(1S,3S,4S)-5-[bis(phenylmethoxy)phosphoryloxymethyl]-2,3,4-trimethylcyclohexyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/O[C@H]1CC(COP(=O)(OCc2ccccc2)OCc2ccccc2)[C@@H](C)[C@H](C)C1C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C26H33Cl3NO5P/c1-18-19(2)23(14-24(20(18)3)35-25(30)26(27,28)29)17-34-36(31,32-15-21-10-6-4-7-11-21)33-16-22-12-8-5-9-13-22/h4-13,18-20,23-24,30H,14-17H2,1-3H3/b30-25+/t18-,19-,20?,23?,24-/m0/s1 |
| InChIKey | UZXJSGWPNYXFNV-ZLBIKESESA-N |
| XLogP | 8.21 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.89 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|