C22H20Cl3NO6 — CID 134834310
[(3R,5S)-5-benzoyloxy-2-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] benzoate (PubChem CID 134834310) has the molecular formula C22H20Cl3NO6 and a molecular weight of 500.76 g/mol. Its IUPAC name is [(3R,5S)-5-benzoyloxy-2-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] benzoate.
| Compound Name | [(3R,5S)-5-benzoyloxy-2-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 134834310 |
| Molecular Formula | C22H20Cl3NO6 |
| Molecular Weight | 500.76 g/mol |
| Exact Mass | 499.04 |
| IUPAC Name | [(3R,5S)-5-benzoyloxy-2-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] benzoate |
| SMILES | [H]/N=C(/OC1OC(C)[C@H](OC(=O)c2ccccc2)C[C@@H]1OC(=O)c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C22H20Cl3NO6/c1-13-16(30-18(27)14-8-4-2-5-9-14)12-17(20(29-13)32-21(26)22(23,24)25)31-19(28)15-10-6-3-7-11-15/h2-11,13,16-17,20,26H,12H2,1H3/b26-21+/t13?,16-,17+,20?/m1/s1 |
| InChIKey | SXMSPUWJQIBPIC-LQZGAYQFSA-N |
| XLogP | 4.94 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.76 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|