C15H14Cl3N7O4 — CID 71662521
[(2R,3S,4S,5R,6R)-3,5-diazido-2-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-4-yl] benzoate (PubChem CID 71662521) has the molecular formula C15H14Cl3N7O4 and a molecular weight of 462.68 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,5-diazido-2-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-4-yl] benzoate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,5-diazido-2-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-4-yl] benzoate |
|---|---|
| PubChem CID | 71662521 |
| Molecular Formula | C15H14Cl3N7O4 |
| Molecular Weight | 462.68 g/mol |
| Exact Mass | 461.02 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,5-diazido-2-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-4-yl] benzoate |
| SMILES | [H]/N=C(/O[C@H]1O[C@H](C)[C@H](N=[N+]=[N-])[C@H](OC(=O)c2ccccc2)[C@H]1N=[N+]=[N-])C(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H14Cl3N7O4/c1-7-9(22-24-20)11(28-12(26)8-5-3-2-4-6-8)10(23-25-21)13(27-7)29-14(19)15(16,17)18/h2-7,9-11,13,19H,1H3/b19-14+/t7-,9+,10-,11+,13-/m1/s1 |
| InChIKey | WHUOCSQYDPFIGB-AARLOVADSA-N |
| XLogP | 4.68 |
| TPSA | 166.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.68 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|