C10H12Cl3N7O4 — CID 71661266
[(2R,3S,4S,5R,6R)-3,5-diazido-2-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-4-yl] acetate (PubChem CID 71661266) has the molecular formula C10H12Cl3N7O4 and a molecular weight of 400.61 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,5-diazido-2-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-4-yl] acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,5-diazido-2-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-4-yl] acetate |
|---|---|
| PubChem CID | 71661266 |
| Molecular Formula | C10H12Cl3N7O4 |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 399.00 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,5-diazido-2-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-4-yl] acetate |
| SMILES | [H]/N=C(/O[C@H]1O[C@H](C)[C@H](N=[N+]=[N-])[C@H](OC(C)=O)[C@H]1N=[N+]=[N-])C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H12Cl3N7O4/c1-3-5(17-19-15)7(23-4(2)21)6(18-20-16)8(22-3)24-9(14)10(11,12)13/h3,5-8,14H,1-2H3/b14-9+/t3-,5+,6-,7+,8-/m1/s1 |
| InChIKey | HGRNSUZSGYPZHM-ZDXHISHTSA-N |
| XLogP | 3.38 |
| TPSA | 166.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|