C12H15Cl3N4O6 — CID 101241637
[(2S,3R,4S,5S,6S)-4-acetyloxy-5-azido-2-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate (PubChem CID 101241637) has the molecular formula C12H15Cl3N4O6 and a molecular weight of 417.63 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6S)-4-acetyloxy-5-azido-2-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate.
| Compound Name | [(2S,3R,4S,5S,6S)-4-acetyloxy-5-azido-2-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 101241637 |
| Molecular Formula | C12H15Cl3N4O6 |
| Molecular Weight | 417.63 g/mol |
| Exact Mass | 416.01 |
| IUPAC Name | [(2S,3R,4S,5S,6S)-4-acetyloxy-5-azido-2-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate |
| SMILES | [H]/N=C(/O[C@@H]1O[C@@H](C)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1N=[N+]=[N-])C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H15Cl3N4O6/c1-4-8(23-5(2)20)9(24-6(3)21)7(18-19-17)10(22-4)25-11(16)12(13,14)15/h4,7-10,16H,1-3H3/b16-11+/t4-,7-,8+,9-,10-/m0/s1 |
| InChIKey | QLYBVIQMCILRJU-CVRYRUKLSA-N |
| XLogP | 2.64 |
| TPSA | 143.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.63 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|