C25H42N4O8 — CID 141448834
ethyl (3R,4R,5S)-4-acetamido-5-[[(ethoxycarbonylamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]-3-pentan-3-yloxycyclohexene-1-carboxylate (PubChem CID 141448834) has the molecular formula C25H42N4O8 and a molecular weight of 526.63 g/mol. Its IUPAC name is ethyl (3R,4R,5S)-4-acetamido-5-[[(ethoxycarbonylamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]-3-pentan-3-yloxycyclohexene-1-carboxylate.
| Compound Name | ethyl (3R,4R,5S)-4-acetamido-5-[[(ethoxycarbonylamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]-3-pentan-3-yloxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 141448834 |
| Molecular Formula | C25H42N4O8 |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.30 |
| IUPAC Name | ethyl (3R,4R,5S)-4-acetamido-5-[[(ethoxycarbonylamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]-3-pentan-3-yloxycyclohexene-1-carboxylate |
| SMILES | CCOC(=O)N/C(=N\[C@H]1CC(C(=O)OCC)=C[C@@H](OC(CC)CC)[C@@H]1NC(C)=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H42N4O8/c1-9-17(10-2)36-19-14-16(21(31)34-11-3)13-18(20(19)26-15(5)30)27-22(28-23(32)35-12-4)29-24(33)37-25(6,7)8/h14,17-20H,9-13H2,1-8H3,(H,26,30)(H2,27,28,29,32,33)/t18-,19+,20+/m0/s1 |
| InChIKey | MIUSLGBYTWKQFZ-XUVXKRRUSA-N |
| XLogP | 2.95 |
| TPSA | 153.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|