C25H42N4O8 — CID 76761337
4-acetamido-5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-3-pentan-3-yloxycyclohexene-1-carboxylic acid (PubChem CID 76761337) has the molecular formula C25H42N4O8 and a molecular weight of 526.63 g/mol. Its IUPAC name is 4-acetamido-5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-3-pentan-3-yloxycyclohexene-1-carboxylic acid.
| Compound Name | 4-acetamido-5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-3-pentan-3-yloxycyclohexene-1-carboxylic acid |
|---|---|
| PubChem CID | 76761337 |
| Molecular Formula | C25H42N4O8 |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.30 |
| IUPAC Name | 4-acetamido-5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-3-pentan-3-yloxycyclohexene-1-carboxylic acid |
| SMILES | CCC(CC)OC1C=C(C(=O)O)CC(N=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)C1NC(C)=O |
| InChI | InChI=1S/C25H42N4O8/c1-10-16(11-2)35-18-13-15(20(31)32)12-17(19(18)26-14(3)30)27-21(28-22(33)36-24(4,5)6)29-23(34)37-25(7,8)9/h13,16-19H,10-12H2,1-9H3,(H,26,30)(H,31,32)(H2,27,28,29,33,34) |
| InChIKey | KBTNGZWAIBBLKM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 164.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|