C18H32N2O4 — CID 68785848
tert-butyl N-[(1S,5R,6R)-6-acetamido-5-pentan-3-yloxycyclohex-3-en-1-yl]carbamate (PubChem CID 68785848) has the molecular formula C18H32N2O4 and a molecular weight of 340.46 g/mol. Its IUPAC name is tert-butyl N-[(1S,5R,6R)-6-acetamido-5-pentan-3-yloxycyclohex-3-en-1-yl]carbamate.
| Compound Name | tert-butyl N-[(1S,5R,6R)-6-acetamido-5-pentan-3-yloxycyclohex-3-en-1-yl]carbamate |
|---|---|
| PubChem CID | 68785848 |
| Molecular Formula | C18H32N2O4 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | tert-butyl N-[(1S,5R,6R)-6-acetamido-5-pentan-3-yloxycyclohex-3-en-1-yl]carbamate |
| SMILES | CCC(CC)O[C@@H]1C=CC[C@H](NC(=O)OC(C)(C)C)[C@H]1NC(C)=O |
| InChI | InChI=1S/C18H32N2O4/c1-7-13(8-2)23-15-11-9-10-14(16(15)19-12(3)21)20-17(22)24-18(4,5)6/h9,11,13-16H,7-8,10H2,1-6H3,(H,19,21)(H,20,22)/t14-,15+,16+/m0/s1 |
| InChIKey | TWKQPFCDMGWTAE-ARFHVFGLSA-N |
| XLogP | 2.92 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|