C18H33NO4 — CID 126608516
tert-butyl N-[(1S,5R,6R)-3-(hydroxymethyl)-6-methyl-5-pentan-3-yloxycyclohex-3-en-1-yl]carbamate (PubChem CID 126608516) has the molecular formula C18H33NO4 and a molecular weight of 327.47 g/mol. Its IUPAC name is tert-butyl N-[(1S,5R,6R)-3-(hydroxymethyl)-6-methyl-5-pentan-3-yloxycyclohex-3-en-1-yl]carbamate.
| Compound Name | tert-butyl N-[(1S,5R,6R)-3-(hydroxymethyl)-6-methyl-5-pentan-3-yloxycyclohex-3-en-1-yl]carbamate |
|---|---|
| PubChem CID | 126608516 |
| Molecular Formula | C18H33NO4 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | tert-butyl N-[(1S,5R,6R)-3-(hydroxymethyl)-6-methyl-5-pentan-3-yloxycyclohex-3-en-1-yl]carbamate |
| SMILES | CCC(CC)O[C@@H]1C=C(CO)C[C@H](NC(=O)OC(C)(C)C)[C@H]1C |
| InChI | InChI=1S/C18H33NO4/c1-7-14(8-2)22-16-10-13(11-20)9-15(12(16)3)19-17(21)23-18(4,5)6/h10,12,14-16,20H,7-9,11H2,1-6H3,(H,19,21)/t12-,15+,16-/m1/s1 |
| InChIKey | QKOUIYOYICWBON-UHOFOFEASA-N |
| XLogP | 3.41 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|