C11H20FNO2 — CID 126652040
tert-butyl N-[(1R,2S,3R)-3-fluoro-2-methylcyclopentyl]carbamate (PubChem CID 126652040) has the molecular formula C11H20FNO2 and a molecular weight of 217.28 g/mol. Its IUPAC name is tert-butyl N-[(1R,2S,3R)-3-fluoro-2-methylcyclopentyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2S,3R)-3-fluoro-2-methylcyclopentyl]carbamate |
|---|---|
| PubChem CID | 126652040 |
| Molecular Formula | C11H20FNO2 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | tert-butyl N-[(1R,2S,3R)-3-fluoro-2-methylcyclopentyl]carbamate |
| SMILES | C[C@@H]1[C@H](F)CC[C@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H20FNO2/c1-7-8(12)5-6-9(7)13-10(14)15-11(2,3)4/h7-9H,5-6H2,1-4H3,(H,13,14)/t7-,8-,9-/m1/s1 |
| InChIKey | MXILWUQGJQYRPI-IWSPIJDZSA-N |
| XLogP | 2.65 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |