C23H36ClN3O2 — CID 141297875
N-[(1R,2R,6S)-6-[3-(2-chloro-6-methylanilino)propylamino]-2-pentan-3-yloxycyclohex-3-en-1-yl]acetamide (PubChem CID 141297875) has the molecular formula C23H36ClN3O2 and a molecular weight of 422.01 g/mol. Its IUPAC name is N-[(1R,2R,6S)-6-[3-(2-chloro-6-methylanilino)propylamino]-2-pentan-3-yloxycyclohex-3-en-1-yl]acetamide.
| Compound Name | N-[(1R,2R,6S)-6-[3-(2-chloro-6-methylanilino)propylamino]-2-pentan-3-yloxycyclohex-3-en-1-yl]acetamide |
|---|---|
| PubChem CID | 141297875 |
| Molecular Formula | C23H36ClN3O2 |
| Molecular Weight | 422.01 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | N-[(1R,2R,6S)-6-[3-(2-chloro-6-methylanilino)propylamino]-2-pentan-3-yloxycyclohex-3-en-1-yl]acetamide |
| SMILES | CCC(CC)O[C@@H]1C=CC[C@H](NCCCNc2c(C)cccc2Cl)[C@H]1NC(C)=O |
| InChI | InChI=1S/C23H36ClN3O2/c1-5-18(6-2)29-21-13-8-12-20(23(21)27-17(4)28)25-14-9-15-26-22-16(3)10-7-11-19(22)24/h7-8,10-11,13,18,20-21,23,25-26H,5-6,9,12,14-15H2,1-4H3,(H,27,28)/t20-,21+,23+/m0/s1 |
| InChIKey | FHEOEGWQDAFLFT-QZNHQXDQSA-N |
| XLogP | 4.45 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.01 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|