C24H42N2O9 — CID 90327017
diethyl (2S,3S,4R,5S)-4-acetamido-2-hydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pentan-3-yloxycyclohexane-1,1-dicarboxylate (PubChem CID 90327017) has the molecular formula C24H42N2O9 and a molecular weight of 502.61 g/mol. Its IUPAC name is diethyl (2S,3S,4R,5S)-4-acetamido-2-hydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pentan-3-yloxycyclohexane-1,1-dicarboxylate.
| Compound Name | diethyl (2S,3S,4R,5S)-4-acetamido-2-hydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pentan-3-yloxycyclohexane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 90327017 |
| Molecular Formula | C24H42N2O9 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.29 |
| IUPAC Name | diethyl (2S,3S,4R,5S)-4-acetamido-2-hydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pentan-3-yloxycyclohexane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C[C@H](NC(=O)OC(C)(C)C)[C@@H](NC(C)=O)[C@H](OC(CC)CC)[C@H]1O |
| InChI | InChI=1S/C24H42N2O9/c1-9-15(10-2)34-18-17(25-14(5)27)16(26-22(31)35-23(6,7)8)13-24(19(18)28,20(29)32-11-3)21(30)33-12-4/h15-19,28H,9-13H2,1-8H3,(H,25,27)(H,26,31)/t16-,17+,18-,19+/m0/s1 |
| InChIKey | NPKBADQZLAHCFN-ZSYWTGECSA-N |
| XLogP | 1.84 |
| TPSA | 149.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|