C22H32ClN3O3 — CID 141297877
3-[[(1S,5R,6R)-6-acetamido-5-pentan-3-yloxycyclohex-3-en-1-yl]amino]-N-(4-chlorophenyl)propanamide (PubChem CID 141297877) has the molecular formula C22H32ClN3O3 and a molecular weight of 421.97 g/mol. Its IUPAC name is 3-[[(1S,5R,6R)-6-acetamido-5-pentan-3-yloxycyclohex-3-en-1-yl]amino]-N-(4-chlorophenyl)propanamide.
| Compound Name | 3-[[(1S,5R,6R)-6-acetamido-5-pentan-3-yloxycyclohex-3-en-1-yl]amino]-N-(4-chlorophenyl)propanamide |
|---|---|
| PubChem CID | 141297877 |
| Molecular Formula | C22H32ClN3O3 |
| Molecular Weight | 421.97 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 3-[[(1S,5R,6R)-6-acetamido-5-pentan-3-yloxycyclohex-3-en-1-yl]amino]-N-(4-chlorophenyl)propanamide |
| SMILES | CCC(CC)O[C@@H]1C=CC[C@H](NCCC(=O)Nc2ccc(Cl)cc2)[C@H]1NC(C)=O |
| InChI | InChI=1S/C22H32ClN3O3/c1-4-18(5-2)29-20-8-6-7-19(22(20)25-15(3)27)24-14-13-21(28)26-17-11-9-16(23)10-12-17/h6,8-12,18-20,22,24H,4-5,7,13-14H2,1-3H3,(H,25,27)(H,26,28)/t19-,20+,22+/m0/s1 |
| InChIKey | QEGTZHJHMVOOPC-TUNNFDKTSA-N |
| XLogP | 3.67 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.97 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|