C17H32NO9PS — CID 175232057
(3R,4S,5R)-4-(diethoxyphosphorylamino)-5-methylsulfonyloxy-3-pentan-3-yloxycyclohexene-1-carboxylic acid (PubChem CID 175232057) has the molecular formula C17H32NO9PS and a molecular weight of 457.48 g/mol. Its IUPAC name is (3R,4S,5R)-4-(diethoxyphosphorylamino)-5-methylsulfonyloxy-3-pentan-3-yloxycyclohexene-1-carboxylic acid.
| Compound Name | (3R,4S,5R)-4-(diethoxyphosphorylamino)-5-methylsulfonyloxy-3-pentan-3-yloxycyclohexene-1-carboxylic acid |
|---|---|
| PubChem CID | 175232057 |
| Molecular Formula | C17H32NO9PS |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | (3R,4S,5R)-4-(diethoxyphosphorylamino)-5-methylsulfonyloxy-3-pentan-3-yloxycyclohexene-1-carboxylic acid |
| SMILES | CCOP(=O)(N[C@H]1[C@H](OC(CC)CC)C=C(C(=O)O)C[C@H]1OS(C)(=O)=O)OCC |
| InChI | InChI=1S/C17H32NO9PS/c1-6-13(7-2)26-14-10-12(17(19)20)11-15(27-29(5,22)23)16(14)18-28(21,24-8-3)25-9-4/h10,13-16H,6-9,11H2,1-5H3,(H,18,21)(H,19,20)/t14-,15-,16+/m1/s1 |
| InChIKey | CEIXVZLKXXCKNB-OAGGEKHMSA-N |
| XLogP | 2.46 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|