C16H19ClFNO4S — CID 142760613
ethyl 5-[(2-chloro-4-fluorophenyl)sulfamoyl]cycloheptene-1-carboxylate (PubChem CID 142760613) has the molecular formula C16H19ClFNO4S and a molecular weight of 375.85 g/mol. Its IUPAC name is ethyl 5-[(2-chloro-4-fluorophenyl)sulfamoyl]cycloheptene-1-carboxylate.
| Compound Name | ethyl 5-[(2-chloro-4-fluorophenyl)sulfamoyl]cycloheptene-1-carboxylate |
|---|---|
| PubChem CID | 142760613 |
| Molecular Formula | C16H19ClFNO4S |
| Molecular Weight | 375.85 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | ethyl 5-[(2-chloro-4-fluorophenyl)sulfamoyl]cycloheptene-1-carboxylate |
| SMILES | CCOC(=O)C1=CCCC(S(=O)(=O)Nc2ccc(F)cc2Cl)CC1 |
| InChI | InChI=1S/C16H19ClFNO4S/c1-2-23-16(20)11-4-3-5-13(8-6-11)24(21,22)19-15-9-7-12(18)10-14(15)17/h4,7,9-10,13,19H,2-3,5-6,8H2,1H3 |
| InChIKey | KBSUUEGBZMTDRR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.85 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |