C19H22BrClFNO6S — CID 67193157
ethyl 3-(2-bromoethyl)-8-[(2-chloro-4-fluorophenyl)sulfamoyl]-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylate (PubChem CID 67193157) has the molecular formula C19H22BrClFNO6S and a molecular weight of 526.81 g/mol. Its IUPAC name is ethyl 3-(2-bromoethyl)-8-[(2-chloro-4-fluorophenyl)sulfamoyl]-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylate.
| Compound Name | ethyl 3-(2-bromoethyl)-8-[(2-chloro-4-fluorophenyl)sulfamoyl]-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylate |
|---|---|
| PubChem CID | 67193157 |
| Molecular Formula | C19H22BrClFNO6S |
| Molecular Weight | 526.81 g/mol |
| Exact Mass | 525.00 |
| IUPAC Name | ethyl 3-(2-bromoethyl)-8-[(2-chloro-4-fluorophenyl)sulfamoyl]-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylate |
| SMILES | CCOC(=O)C1=CC2(CCC1S(=O)(=O)Nc1ccc(F)cc1Cl)OCC(CCBr)O2 |
| InChI | InChI=1S/C19H22BrClFNO6S/c1-2-27-18(24)14-10-19(28-11-13(29-19)6-8-20)7-5-17(14)30(25,26)23-16-4-3-12(22)9-15(16)21/h3-4,9-10,13,17,23H,2,5-8,11H2,1H3 |
| InChIKey | GXXMDEHYYFTKMZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.81 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|