C15H17ClFNO4S — CID 25204712
ethyl (6R)-6-[(2-chloro-4-fluorophenyl)sulfamoyl]-2,3,3,5,5,6-hexadeuteriocyclohexene-1-carboxylate (PubChem CID 25204712) has the molecular formula C15H17ClFNO4S and a molecular weight of 367.86 g/mol. Its IUPAC name is ethyl (6R)-6-[(2-chloro-4-fluorophenyl)sulfamoyl]-2,3,3,5,5,6-hexadeuteriocyclohexene-1-carboxylate.
| Compound Name | ethyl (6R)-6-[(2-chloro-4-fluorophenyl)sulfamoyl]-2,3,3,5,5,6-hexadeuteriocyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 25204712 |
| Molecular Formula | C15H17ClFNO4S |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | ethyl (6R)-6-[(2-chloro-4-fluorophenyl)sulfamoyl]-2,3,3,5,5,6-hexadeuteriocyclohexene-1-carboxylate |
| SMILES | [2H]C1=C(C(=O)OCC)[C@]([2H])(S(=O)(=O)Nc2ccc(F)cc2Cl)C([2H])([2H])CC1([2H])[2H] |
| InChI | InChI=1S/C15H17ClFNO4S/c1-2-22-15(19)11-5-3-4-6-14(11)23(20,21)18-13-8-7-10(17)9-12(13)16/h5,7-9,14,18H,2-4,6H2,1H3/t14-/m1/s1/i3D2,5D,6D2,14D |
| InChIKey | LEEIJTHMHDMWLJ-FQFHEVDNSA-N |
| XLogP | 3.26 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |