C20H22ClFO7S — CID 159038816
ethyl 6'-[(2-chloro-4-fluorophenyl)methylsulfonyl]spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,3'-cyclohexene]-1'-carboxylate (PubChem CID 159038816) has the molecular formula C20H22ClFO7S and a molecular weight of 460.91 g/mol. Its IUPAC name is ethyl 6'-[(2-chloro-4-fluorophenyl)methylsulfonyl]spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,3'-cyclohexene]-1'-carboxylate.
| Compound Name | ethyl 6'-[(2-chloro-4-fluorophenyl)methylsulfonyl]spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,3'-cyclohexene]-1'-carboxylate |
|---|---|
| PubChem CID | 159038816 |
| Molecular Formula | C20H22ClFO7S |
| Molecular Weight | 460.91 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | ethyl 6'-[(2-chloro-4-fluorophenyl)methylsulfonyl]spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,3'-cyclohexene]-1'-carboxylate |
| SMILES | CCOC(=O)C1=CC2(CCC1S(=O)(=O)Cc1ccc(F)cc1Cl)OC1COCC1O2 |
| InChI | InChI=1S/C20H22ClFO7S/c1-2-27-19(23)14-8-20(28-16-9-26-10-17(16)29-20)6-5-18(14)30(24,25)11-12-3-4-13(22)7-15(12)21/h3-4,7-8,16-18H,2,5-6,9-11H2,1H3 |
| InChIKey | JVUCFOYNIKWFSQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.91 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |