C18H19F3O6S — CID 161498307
ethyl 8-[(2,4,5-trifluorophenyl)methylsulfonyl]-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylate (PubChem CID 161498307) has the molecular formula C18H19F3O6S and a molecular weight of 420.41 g/mol. Its IUPAC name is ethyl 8-[(2,4,5-trifluorophenyl)methylsulfonyl]-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylate.
| Compound Name | ethyl 8-[(2,4,5-trifluorophenyl)methylsulfonyl]-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylate |
|---|---|
| PubChem CID | 161498307 |
| Molecular Formula | C18H19F3O6S |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | ethyl 8-[(2,4,5-trifluorophenyl)methylsulfonyl]-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylate |
| SMILES | CCOC(=O)C1=CC2(CCC1S(=O)(=O)Cc1cc(F)c(F)cc1F)OCCO2 |
| InChI | InChI=1S/C18H19F3O6S/c1-2-25-17(22)12-9-18(26-5-6-27-18)4-3-16(12)28(23,24)10-11-7-14(20)15(21)8-13(11)19/h7-9,16H,2-6,10H2,1H3 |
| InChIKey | WGMUODMANTZVTQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|