C16H16ClFO5S — CID 161172356
ethyl 6-[(2-chloro-4-fluorophenyl)methylsulfonyl]-3-oxocyclohexene-1-carboxylate (PubChem CID 161172356) has the molecular formula C16H16ClFO5S and a molecular weight of 374.82 g/mol. Its IUPAC name is ethyl 6-[(2-chloro-4-fluorophenyl)methylsulfonyl]-3-oxocyclohexene-1-carboxylate.
| Compound Name | ethyl 6-[(2-chloro-4-fluorophenyl)methylsulfonyl]-3-oxocyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 161172356 |
| Molecular Formula | C16H16ClFO5S |
| Molecular Weight | 374.82 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | ethyl 6-[(2-chloro-4-fluorophenyl)methylsulfonyl]-3-oxocyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=CC(=O)CCC1S(=O)(=O)Cc1ccc(F)cc1Cl |
| InChI | InChI=1S/C16H16ClFO5S/c1-2-23-16(20)13-8-12(19)5-6-15(13)24(21,22)9-10-3-4-11(18)7-14(10)17/h3-4,7-8,15H,2,5-6,9H2,1H3 |
| InChIKey | URIUADYGKWODPJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.82 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |