C18H22ClFO4S — CID 134346014
ethyl 6-[(2-chloro-4-fluorophenyl)methylsulfanyl]-3,3-dimethoxycyclohexene-1-carboxylate (PubChem CID 134346014) has the molecular formula C18H22ClFO4S and a molecular weight of 388.89 g/mol. Its IUPAC name is ethyl 6-[(2-chloro-4-fluorophenyl)methylsulfanyl]-3,3-dimethoxycyclohexene-1-carboxylate.
| Compound Name | ethyl 6-[(2-chloro-4-fluorophenyl)methylsulfanyl]-3,3-dimethoxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 134346014 |
| Molecular Formula | C18H22ClFO4S |
| Molecular Weight | 388.89 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | ethyl 6-[(2-chloro-4-fluorophenyl)methylsulfanyl]-3,3-dimethoxycyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=CC(OC)(OC)CCC1SCc1ccc(F)cc1Cl |
| InChI | InChI=1S/C18H22ClFO4S/c1-4-24-17(21)14-10-18(22-2,23-3)8-7-16(14)25-11-12-5-6-13(20)9-15(12)19/h5-6,9-10,16H,4,7-8,11H2,1-3H3 |
| InChIKey | JIESYAHALXRCDD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.89 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|