C13H14ClFO2S2 — CID 161332842
(6R)-6-[(2-chloro-4-fluorophenyl)methylsulfonyl]cyclohexene-1-thiol (PubChem CID 161332842) has the molecular formula C13H14ClFO2S2 and a molecular weight of 320.84 g/mol. Its IUPAC name is (6R)-6-[(2-chloro-4-fluorophenyl)methylsulfonyl]cyclohexene-1-thiol.
| Compound Name | (6R)-6-[(2-chloro-4-fluorophenyl)methylsulfonyl]cyclohexene-1-thiol |
|---|---|
| PubChem CID | 161332842 |
| Molecular Formula | C13H14ClFO2S2 |
| Molecular Weight | 320.84 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | (6R)-6-[(2-chloro-4-fluorophenyl)methylsulfonyl]cyclohexene-1-thiol |
| SMILES | O=S(=O)(Cc1ccc(F)cc1Cl)[C@@H]1CCCC=C1S |
| InChI | InChI=1S/C13H14ClFO2S2/c14-11-7-10(15)6-5-9(11)8-19(16,17)13-4-2-1-3-12(13)18/h3,5-7,13,18H,1-2,4,8H2/t13-/m1/s1 |
| InChIKey | VLQMJHZITWZMQP-CYBMUJFWSA-N |
| XLogP | 3.76 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.84 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|