C9H11BrF2OS — CID 11781090
(1S,4R)-3-bromo-3-[difluoro(methylsulfanyl)methyl]bicyclo[2.2.1]heptan-2-one (PubChem CID 11781090) has the molecular formula C9H11BrF2OS and a molecular weight of 285.15 g/mol. Its IUPAC name is (1S,4R)-3-bromo-3-[difluoro(methylsulfanyl)methyl]bicyclo[2.2.1]heptan-2-one.
| Compound Name | (1S,4R)-3-bromo-3-[difluoro(methylsulfanyl)methyl]bicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 11781090 |
| Molecular Formula | C9H11BrF2OS |
| Molecular Weight | 285.15 g/mol |
| Exact Mass | 283.97 |
| IUPAC Name | (1S,4R)-3-bromo-3-[difluoro(methylsulfanyl)methyl]bicyclo[2.2.1]heptan-2-one |
| SMILES | CSC(F)(F)C1(Br)C(=O)[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C9H11BrF2OS/c1-14-9(11,12)8(10)6-3-2-5(4-6)7(8)13/h5-6H,2-4H2,1H3/t5-,6+,8?/m0/s1 |
| InChIKey | KUQDKNIMPPZORS-FWHJPCMOSA-N |
| XLogP | 3.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.15 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|