C10H15NO2 — CID 177403291
(3Z)-2,2-dimethyl-3-(nitromethylidene)bicyclo[2.2.1]heptane (PubChem CID 177403291) has the molecular formula C10H15NO2 and a molecular weight of 181.24 g/mol. Its IUPAC name is (3Z)-2,2-dimethyl-3-(nitromethylidene)bicyclo[2.2.1]heptane.
| Compound Name | (3Z)-2,2-dimethyl-3-(nitromethylidene)bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 177403291 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | (3Z)-2,2-dimethyl-3-(nitromethylidene)bicyclo[2.2.1]heptane |
| SMILES | CC1(C)/C(=C\[N+](=O)[O-])C2CCC1C2 |
| InChI | InChI=1S/C10H15NO2/c1-10(2)8-4-3-7(5-8)9(10)6-11(12)13/h6-8H,3-5H2,1-2H3/b9-6- |
| InChIKey | YSRRDKSJZLZZDU-TWGQIWQCSA-N |
| XLogP | 2.60 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|