C11H15O2- — CID 7324932
(2E)-2-[(1S,4R)-3,3-dimethyl-2-bicyclo[2.2.1]heptanylidene]acetate (PubChem CID 7324932) has the molecular formula C11H15O2- and a molecular weight of 179.24 g/mol. Its IUPAC name is (2E)-2-[(1S,4R)-3,3-dimethyl-2-bicyclo[2.2.1]heptanylidene]acetate.
| Compound Name | (2E)-2-[(1S,4R)-3,3-dimethyl-2-bicyclo[2.2.1]heptanylidene]acetate |
|---|---|
| PubChem CID | 7324932 |
| Molecular Formula | C11H15O2- |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | (2E)-2-[(1S,4R)-3,3-dimethyl-2-bicyclo[2.2.1]heptanylidene]acetate |
| SMILES | CC1(C)/C(=C/C(=O)[O-])[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C11H16O2/c1-11(2)8-4-3-7(5-8)9(11)6-10(12)13/h6-8H,3-5H2,1-2H3,(H,12,13)/p-1/b9-6+/t7-,8+/m0/s1 |
| InChIKey | XXBXCBIFNWCCMR-HNEQRXQUSA-M |
| XLogP | 1.12 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|