C10H17N3O — CID 6284943
[(Z)-(3,3-dimethyl-2-bicyclo[2.2.1]heptanylidene)amino]urea (PubChem CID 6284943) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is [(Z)-(3,3-dimethyl-2-bicyclo[2.2.1]heptanylidene)amino]urea.
| Compound Name | [(Z)-(3,3-dimethyl-2-bicyclo[2.2.1]heptanylidene)amino]urea |
|---|---|
| PubChem CID | 6284943 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | [(Z)-(3,3-dimethyl-2-bicyclo[2.2.1]heptanylidene)amino]urea |
| SMILES | CC1(C)/C(=N\NC(N)=O)C2CCC1C2 |
| InChI | InChI=1S/C10H17N3O/c1-10(2)7-4-3-6(5-7)8(10)12-13-9(11)14/h6-7H,3-5H2,1-2H3,(H3,11,13,14)/b12-8- |
| InChIKey | JIXUDARVWQCSOK-WQLSENKSSA-N |
| XLogP | 1.47 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|