C10H15N3O — CID 5465872
[(Z)-2-tricyclo[3.3.1.03,7]nonanylideneamino]urea (PubChem CID 5465872) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is [(Z)-2-tricyclo[3.3.1.03,7]nonanylideneamino]urea.
| Compound Name | [(Z)-2-tricyclo[3.3.1.03,7]nonanylideneamino]urea |
|---|---|
| PubChem CID | 5465872 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | [(Z)-2-tricyclo[3.3.1.03,7]nonanylideneamino]urea |
| SMILES | NC(=O)N/N=C1/C2CC3CC(C2)C1C3 |
| InChI | InChI=1S/C10H15N3O/c11-10(14)13-12-9-7-2-5-1-6(4-7)8(9)3-5/h5-8H,1-4H2,(H3,11,13,14)/b12-9- |
| InChIKey | DXOBGVCNIGRXSG-XFXZXTDPSA-N |
| XLogP | 1.08 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|