C14H18O2 — CID 11171999
(1S,3R,3'S,4R)-3'-acetyl-1'-methylspiro[bicyclo[2.2.1]heptane-3,5'-cyclopentene]-2-one (PubChem CID 11171999) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is (1S,3R,3'S,4R)-3'-acetyl-1'-methylspiro[bicyclo[2.2.1]heptane-3,5'-cyclopentene]-2-one.
| Compound Name | (1S,3R,3'S,4R)-3'-acetyl-1'-methylspiro[bicyclo[2.2.1]heptane-3,5'-cyclopentene]-2-one |
|---|---|
| PubChem CID | 11171999 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (1S,3R,3'S,4R)-3'-acetyl-1'-methylspiro[bicyclo[2.2.1]heptane-3,5'-cyclopentene]-2-one |
| SMILES | CC(=O)[C@@H]1C=C(C)[C@]2(C1)C(=O)[C@H]1CC[C@@H]2C1 |
| InChI | InChI=1S/C14H18O2/c1-8-5-11(9(2)15)7-14(8)12-4-3-10(6-12)13(14)16/h5,10-12H,3-4,6-7H2,1-2H3/t10-,11+,12+,14-/m0/s1 |
| InChIKey | PIRRWFBIZUSGBE-SFTQSGBHSA-N |
| XLogP | 2.53 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|