C19H22IN — CID 102092777
(2R,3R)-3-(4-iodobutyl)-1,2-diphenylazetidine (PubChem CID 102092777) has the molecular formula C19H22IN and a molecular weight of 391.30 g/mol. Its IUPAC name is (2R,3R)-3-(4-iodobutyl)-1,2-diphenylazetidine.
| Compound Name | (2R,3R)-3-(4-iodobutyl)-1,2-diphenylazetidine |
|---|---|
| PubChem CID | 102092777 |
| Molecular Formula | C19H22IN |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | (2R,3R)-3-(4-iodobutyl)-1,2-diphenylazetidine |
| SMILES | ICCCC[C@@H]1CN(c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H22IN/c20-14-8-7-11-17-15-21(18-12-5-2-6-13-18)19(17)16-9-3-1-4-10-16/h1-6,9-10,12-13,17,19H,7-8,11,14-15H2/t17-,19+/m1/s1 |
| InChIKey | FMURNWODBXWXAQ-MJGOQNOKSA-N |
| XLogP | 5.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|