About (2R,3R)-3-(4-iodobutyl)-1,2-diphenylazetidine
(2R,3R)-3-(4-iodobutyl)-1,2-diphenylazetidine (PubChem CID 102092777) has the molecular formula C19H22IN
and a molecular weight of 391.30 g/mol. Its IUPAC name is (2R,3R)-3-(4-iodobutyl)-1,2-diphenylazetidine.
Molecular Properties
| Compound Name | (2R,3R)-3-(4-iodobutyl)-1,2-diphenylazetidine |
| PubChem CID | 102092777 |
| Molecular Formula | C19H22IN |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | (2R,3R)-3-(4-iodobutyl)-1,2-diphenylazetidine |
| SMILES | ICCCC[C@@H]1CN(c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H22IN/c20-14-8-7-11-17-15-21(18-12-5-2-6-13-18)19(17)16-9-3-1-4-10-16/h1-6,9-10,12-13,17,19H,7-8,11,14-15H2/t17-,19+/m1/s1 |
| InChIKey | FMURNWODBXWXAQ-MJGOQNOKSA-N |
| XLogP | 5.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2R,3R)-3-(4-iodobutyl)-1,2-diphenylazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-3-(4-iodobutyl)-1,2-diphenylazetidine?
The IUPAC name of (2R,3R)-3-(4-iodobutyl)-1,2-diphenylazetidine (CID 102092777) is (2R,3R)-3-(4-iodobutyl)-1,2-diphenylazetidine.
What is the SMILES notation for (2R,3R)-3-(4-iodobutyl)-1,2-diphenylazetidine?
The canonical SMILES for (2R,3R)-3-(4-iodobutyl)-1,2-diphenylazetidine is ICCCC[C@@H]1CN(c2ccccc2)[C@H]1c1ccccc1.
What is the InChIKey of (2R,3R)-3-(4-iodobutyl)-1,2-diphenylazetidine?
The InChIKey is FMURNWODBXWXAQ-MJGOQNOKSA-N. The full InChI is InChI=1S/C19H22IN/c20-14-8-7-11-17-15-21(18-12-5-2-6-13-18)19(17)16-9-3-1-4-10-16/h1-6,9-10,12-13,17,19H,7-8,11,14-15H2/t17-,19+/m1/s1.
What are the key properties of (2R,3R)-3-(4-iodobutyl)-1,2-diphenylazetidine?
(2R,3R)-3-(4-iodobutyl)-1,2-diphenylazetidine has a molecular weight of 391.30 g/mol, XLogP of 5.47, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-3-(4-iodobutyl)-1,2-diphenylazetidine is sourced from PubChem (CID 102092777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).