C19H22O — CID 101348486
(1R,4Z,5R,6S)-4-benzylidene-5-methyl-7-methylidene-2-oxatricyclo[4.3.2.01,5]undecane (PubChem CID 101348486) has the molecular formula C19H22O and a molecular weight of 266.38 g/mol. Its IUPAC name is (1R,4Z,5R,6S)-4-benzylidene-5-methyl-7-methylidene-2-oxatricyclo[4.3.2.01,5]undecane.
| Compound Name | (1R,4Z,5R,6S)-4-benzylidene-5-methyl-7-methylidene-2-oxatricyclo[4.3.2.01,5]undecane |
|---|---|
| PubChem CID | 101348486 |
| Molecular Formula | C19H22O |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | (1R,4Z,5R,6S)-4-benzylidene-5-methyl-7-methylidene-2-oxatricyclo[4.3.2.01,5]undecane |
| SMILES | C=C1CC[C@]23CC[C@@H]1[C@]2(C)/C(=C/c1ccccc1)CO3 |
| InChI | InChI=1S/C19H22O/c1-14-8-10-19-11-9-17(14)18(19,2)16(13-20-19)12-15-6-4-3-5-7-15/h3-7,12,17H,1,8-11,13H2,2H3/b16-12+/t17-,18-,19-/m0/s1 |
| InChIKey | HBFZSIWYDNYZCF-CSVUPWSLSA-N |
| XLogP | 4.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|