C19H21NO2 — CID 10902514
(1R,2R,5Z,9R)-5-benzylidene-2,10,10-trimethyl-3-oxa-6-azatricyclo[7.1.1.02,7]undec-6-en-4-one (PubChem CID 10902514) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is (1R,2R,5Z,9R)-5-benzylidene-2,10,10-trimethyl-3-oxa-6-azatricyclo[7.1.1.02,7]undec-6-en-4-one.
| Compound Name | (1R,2R,5Z,9R)-5-benzylidene-2,10,10-trimethyl-3-oxa-6-azatricyclo[7.1.1.02,7]undec-6-en-4-one |
|---|---|
| PubChem CID | 10902514 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | (1R,2R,5Z,9R)-5-benzylidene-2,10,10-trimethyl-3-oxa-6-azatricyclo[7.1.1.02,7]undec-6-en-4-one |
| SMILES | CC1(C)[C@H]2CC3=N/C(=C\c4ccccc4)C(=O)O[C@]3(C)[C@@H]1C2 |
| InChI | InChI=1S/C19H21NO2/c1-18(2)13-10-15(18)19(3)16(11-13)20-14(17(21)22-19)9-12-7-5-4-6-8-12/h4-9,13,15H,10-11H2,1-3H3/b14-9-/t13-,15-,19-/m1/s1 |
| InChIKey | WNCMOHLTVWXZTG-MCOSZDOESA-N |
| XLogP | 3.85 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|