C21H24FNO4 — CID 10248696
(1S,2S,5E,9S)-5-[(2-(18F)fluoro-4,5-dimethoxyphenyl)methylidene]-2,10,10-trimethyl-3-oxa-6-azatricyclo[7.1.1.02,7]undec-6-en-4-one (PubChem CID 10248696) has the molecular formula C21H24FNO4 and a molecular weight of 372.43 g/mol. Its IUPAC name is (1S,2S,5E,9S)-5-[(2-(18F)fluoro-4,5-dimethoxyphenyl)methylidene]-2,10,10-trimethyl-3-oxa-6-azatricyclo[7.1.1.02,7]undec-6-en-4-one.
| Compound Name | (1S,2S,5E,9S)-5-[(2-(18F)fluoro-4,5-dimethoxyphenyl)methylidene]-2,10,10-trimethyl-3-oxa-6-azatricyclo[7.1.1.02,7]undec-6-en-4-one |
|---|---|
| PubChem CID | 10248696 |
| Molecular Formula | C21H24FNO4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | (1S,2S,5E,9S)-5-[(2-(18F)fluoro-4,5-dimethoxyphenyl)methylidene]-2,10,10-trimethyl-3-oxa-6-azatricyclo[7.1.1.02,7]undec-6-en-4-one |
| SMILES | COc1cc([18F])c(/C=C2/N=C3C[C@@H]4C[C@@H](C4(C)C)[C@]3(C)OC2=O)cc1OC |
| InChI | InChI=1S/C21H24FNO4/c1-20(2)12-8-17(20)21(3)18(9-12)23-14(19(24)27-21)6-11-7-15(25-4)16(26-5)10-13(11)22/h6-7,10,12,17H,8-9H2,1-5H3/b14-6+/t12-,17-,21-/m0/s1/i22-1 |
| InChIKey | XQOOTVNMRHKNGV-AGPYTJRMSA-N |
| XLogP | 4.01 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|