About CID 89110154
CID 89110154 (PubChem CID 89110154) has the molecular formula C9H9BFO2
and a molecular weight of 178.98 g/mol.
Molecular Properties
| Compound Name | CID 89110154 |
| PubChem CID | 89110154 |
| Molecular Formula | C9H9BFO2 |
| Molecular Weight | 178.98 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | — |
| SMILES | [B]=Cc1cc(OC)c(OC)cc1F |
| InChI | InChI=1S/C9H9BFO2/c1-12-8-3-6(5-10)7(11)4-9(8)13-2/h3-5H,1-2H3 |
| InChIKey | NUWQOTDDGMDKLS-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.98 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 89110154 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89110154?
The IUPAC name of CID 89110154 (CID 89110154) is not available.
What is the SMILES notation for CID 89110154?
The canonical SMILES for CID 89110154 is [B]=Cc1cc(OC)c(OC)cc1F.
What is the InChIKey of CID 89110154?
The InChIKey is NUWQOTDDGMDKLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BFO2/c1-12-8-3-6(5-10)7(11)4-9(8)13-2/h3-5H,1-2H3.
What are the key properties of CID 89110154?
CID 89110154 has a molecular weight of 178.98 g/mol, XLogP of 1.16, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89110154 is sourced from PubChem (CID 89110154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).