C8H5F3O2 — CID 105443995
2,3,4-trifluoro-6-methoxybenzaldehyde (PubChem CID 105443995) has the molecular formula C8H5F3O2 and a molecular weight of 190.12 g/mol. Its IUPAC name is 2,3,4-trifluoro-6-methoxybenzaldehyde.
| Compound Name | 2,3,4-trifluoro-6-methoxybenzaldehyde |
|---|---|
| PubChem CID | 105443995 |
| Molecular Formula | C8H5F3O2 |
| Molecular Weight | 190.12 g/mol |
| Exact Mass | 190.02 |
| IUPAC Name | 2,3,4-trifluoro-6-methoxybenzaldehyde |
| SMILES | COc1cc(F)c(F)c(F)c1C=O |
| InChI | InChI=1S/C8H5F3O2/c1-13-6-2-5(9)8(11)7(10)4(6)3-12/h2-3H,1H3 |
| InChIKey | WBFUNWUIACVBSM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.12 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|