C16H24O2 — CID 102291844
(1S,2R,4S)-2-benzyl-7,7-dimethylcycloheptane-1,4-diol (PubChem CID 102291844) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (1S,2R,4S)-2-benzyl-7,7-dimethylcycloheptane-1,4-diol.
| Compound Name | (1S,2R,4S)-2-benzyl-7,7-dimethylcycloheptane-1,4-diol |
|---|---|
| PubChem CID | 102291844 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (1S,2R,4S)-2-benzyl-7,7-dimethylcycloheptane-1,4-diol |
| SMILES | CC1(C)CC[C@H](O)C[C@@H](Cc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C16H24O2/c1-16(2)9-8-14(17)11-13(15(16)18)10-12-6-4-3-5-7-12/h3-7,13-15,17-18H,8-11H2,1-2H3/t13-,14+,15+/m1/s1 |
| InChIKey | WUWKSEBZCRAGKU-ILXRZTDVSA-N |
| XLogP | 2.78 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |