C14H18O2S — CID 10890339
[(1R,3S)-3-phenylsulfanylcyclohexyl] acetate (PubChem CID 10890339) has the molecular formula C14H18O2S and a molecular weight of 250.36 g/mol. Its IUPAC name is [(1R,3S)-3-phenylsulfanylcyclohexyl] acetate.
| Compound Name | [(1R,3S)-3-phenylsulfanylcyclohexyl] acetate |
|---|---|
| PubChem CID | 10890339 |
| Molecular Formula | C14H18O2S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | [(1R,3S)-3-phenylsulfanylcyclohexyl] acetate |
| SMILES | CC(=O)O[C@@H]1CCC[C@H](Sc2ccccc2)C1 |
| InChI | InChI=1S/C14H18O2S/c1-11(15)16-12-6-5-9-14(10-12)17-13-7-3-2-4-8-13/h2-4,7-8,12,14H,5-6,9-10H2,1H3/t12-,14+/m1/s1 |
| InChIKey | SWHIAIMBNQNAJW-OCCSQVGLSA-N |
| XLogP | 3.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |