C12H22O2 — CID 22861757
[(1R,3R)-3-tert-butylcyclohexyl] acetate (PubChem CID 22861757) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is [(1R,3R)-3-tert-butylcyclohexyl] acetate.
| Compound Name | [(1R,3R)-3-tert-butylcyclohexyl] acetate |
|---|---|
| PubChem CID | 22861757 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | [(1R,3R)-3-tert-butylcyclohexyl] acetate |
| SMILES | CC(=O)O[C@@H]1CCC[C@@H](C(C)(C)C)C1 |
| InChI | InChI=1S/C12H22O2/c1-9(13)14-11-7-5-6-10(8-11)12(2,3)4/h10-11H,5-8H2,1-4H3/t10-,11-/m1/s1 |
| InChIKey | NHUNEDUXIBOQML-GHMZBOCLSA-N |
| XLogP | 3.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |