C18H32O2 — CID 18640217
[(1R,3R)-3-(4-butylcyclohexyl)cyclohexyl] acetate (PubChem CID 18640217) has the molecular formula C18H32O2 and a molecular weight of 280.45 g/mol. Its IUPAC name is [(1R,3R)-3-(4-butylcyclohexyl)cyclohexyl] acetate.
| Compound Name | [(1R,3R)-3-(4-butylcyclohexyl)cyclohexyl] acetate |
|---|---|
| PubChem CID | 18640217 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | [(1R,3R)-3-(4-butylcyclohexyl)cyclohexyl] acetate |
| SMILES | CCCCC1CCC([C@@H]2CCC[C@@H](OC(C)=O)C2)CC1 |
| InChI | InChI=1S/C18H32O2/c1-3-4-6-15-9-11-16(12-10-15)17-7-5-8-18(13-17)20-14(2)19/h15-18H,3-13H2,1-2H3/t15?,16?,17-,18-/m1/s1 |
| InChIKey | RXBSFNHWCJGMNG-OPQOLIRYSA-N |
| XLogP | 5.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |