C19H34O2 — CID 70371568
[(1R,3R)-3-(4-butylcyclohexyl)cyclohexyl] propanoate (PubChem CID 70371568) has the molecular formula C19H34O2 and a molecular weight of 294.48 g/mol. Its IUPAC name is [(1R,3R)-3-(4-butylcyclohexyl)cyclohexyl] propanoate.
| Compound Name | [(1R,3R)-3-(4-butylcyclohexyl)cyclohexyl] propanoate |
|---|---|
| PubChem CID | 70371568 |
| Molecular Formula | C19H34O2 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.26 |
| IUPAC Name | [(1R,3R)-3-(4-butylcyclohexyl)cyclohexyl] propanoate |
| SMILES | CCCCC1CCC([C@@H]2CCC[C@@H](OC(=O)CC)C2)CC1 |
| InChI | InChI=1S/C19H34O2/c1-3-5-7-15-10-12-16(13-11-15)17-8-6-9-18(14-17)21-19(20)4-2/h15-18H,3-14H2,1-2H3/t15?,16?,17-,18-/m1/s1 |
| InChIKey | XXACCJWVJWXFDT-OPQOLIRYSA-N |
| XLogP | 5.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |