C20H38O — CID 18640354
1-pentyl-4-[(1R,3R)-3-propoxycyclohexyl]cyclohexane (PubChem CID 18640354) has the molecular formula C20H38O and a molecular weight of 294.52 g/mol. Its IUPAC name is 1-pentyl-4-[(1R,3R)-3-propoxycyclohexyl]cyclohexane.
| Compound Name | 1-pentyl-4-[(1R,3R)-3-propoxycyclohexyl]cyclohexane |
|---|---|
| PubChem CID | 18640354 |
| Molecular Formula | C20H38O |
| Molecular Weight | 294.52 g/mol |
| Exact Mass | 294.29 |
| IUPAC Name | 1-pentyl-4-[(1R,3R)-3-propoxycyclohexyl]cyclohexane |
| SMILES | CCCCCC1CCC([C@@H]2CCC[C@@H](OCCC)C2)CC1 |
| InChI | InChI=1S/C20H38O/c1-3-5-6-8-17-11-13-18(14-12-17)19-9-7-10-20(16-19)21-15-4-2/h17-20H,3-16H2,1-2H3/t17?,18?,19-,20-/m1/s1 |
| InChIKey | JZKQYUOJBCZZBC-NTFDOXNWSA-N |
| XLogP | 6.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.52 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|