C17H22O2S — CID 154716871
methyl (1R,5S)-7-phenylsulfanylbicyclo[3.3.1]nonane-3-carboxylate (PubChem CID 154716871) has the molecular formula C17H22O2S and a molecular weight of 290.43 g/mol. Its IUPAC name is methyl (1R,5S)-7-phenylsulfanylbicyclo[3.3.1]nonane-3-carboxylate.
| Compound Name | methyl (1R,5S)-7-phenylsulfanylbicyclo[3.3.1]nonane-3-carboxylate |
|---|---|
| PubChem CID | 154716871 |
| Molecular Formula | C17H22O2S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | methyl (1R,5S)-7-phenylsulfanylbicyclo[3.3.1]nonane-3-carboxylate |
| SMILES | COC(=O)C1C[C@H]2CC(Sc3ccccc3)C[C@@H](C1)C2 |
| InChI | InChI=1S/C17H22O2S/c1-19-17(18)14-8-12-7-13(9-14)11-16(10-12)20-15-5-3-2-4-6-15/h2-6,12-14,16H,7-11H2,1H3/t12-,13+,14?,16? |
| InChIKey | XVPPAMLPDNHGSU-KKNUOHPOSA-N |
| XLogP | 4.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |