C14H17NO4S — CID 102373546
dimethyl (2S)-5-phenylsulfanylpyrrolidine-1,2-dicarboxylate (PubChem CID 102373546) has the molecular formula C14H17NO4S and a molecular weight of 295.36 g/mol. Its IUPAC name is dimethyl (2S)-5-phenylsulfanylpyrrolidine-1,2-dicarboxylate.
| Compound Name | dimethyl (2S)-5-phenylsulfanylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 102373546 |
| Molecular Formula | C14H17NO4S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | dimethyl (2S)-5-phenylsulfanylpyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1CCC(Sc2ccccc2)N1C(=O)OC |
| InChI | InChI=1S/C14H17NO4S/c1-18-13(16)11-8-9-12(15(11)14(17)19-2)20-10-6-4-3-5-7-10/h3-7,11-12H,8-9H2,1-2H3/t11-,12?/m0/s1 |
| InChIKey | WKJUMAUULDEOEO-PXYINDEMSA-N |
| XLogP | 2.51 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |