C21H22NO6PSe — CID 10553240
1-O-diphenylphosphinoselenoyl 2-O,5-O-dimethyl (2R,5R)-pyrrolidine-1,2,5-tricarboxylate (PubChem CID 10553240) has the molecular formula C21H22NO6PSe and a molecular weight of 494.34 g/mol. Its IUPAC name is 1-O-diphenylphosphinoselenoyl 2-O,5-O-dimethyl (2R,5R)-pyrrolidine-1,2,5-tricarboxylate.
| Compound Name | 1-O-diphenylphosphinoselenoyl 2-O,5-O-dimethyl (2R,5R)-pyrrolidine-1,2,5-tricarboxylate |
|---|---|
| PubChem CID | 10553240 |
| Molecular Formula | C21H22NO6PSe |
| Molecular Weight | 494.34 g/mol |
| Exact Mass | 495.03 |
| IUPAC Name | 1-O-diphenylphosphinoselenoyl 2-O,5-O-dimethyl (2R,5R)-pyrrolidine-1,2,5-tricarboxylate |
| SMILES | COC(=O)[C@H]1CC[C@H](C(=O)OC)N1C(=O)OP(=[Se])(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H22NO6PSe/c1-26-19(23)17-13-14-18(20(24)27-2)22(17)21(25)28-29(30,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,17-18H,13-14H2,1-2H3/t17-,18-/m1/s1 |
| InChIKey | KVYCCHZIWCUDBS-QZTJIDSGSA-N |
| XLogP | 1.97 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|