C19H28NO6P — CID 53468019
methyl (2S)-1-benzoyl-5-di(propan-2-yloxy)phosphorylpyrrolidine-2-carboxylate (PubChem CID 53468019) has the molecular formula C19H28NO6P and a molecular weight of 397.41 g/mol. Its IUPAC name is methyl (2S)-1-benzoyl-5-di(propan-2-yloxy)phosphorylpyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-benzoyl-5-di(propan-2-yloxy)phosphorylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 53468019 |
| Molecular Formula | C19H28NO6P |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | methyl (2S)-1-benzoyl-5-di(propan-2-yloxy)phosphorylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CCC(P(=O)(OC(C)C)OC(C)C)N1C(=O)c1ccccc1 |
| InChI | InChI=1S/C19H28NO6P/c1-13(2)25-27(23,26-14(3)4)17-12-11-16(19(22)24-5)20(17)18(21)15-9-7-6-8-10-15/h6-10,13-14,16-17H,11-12H2,1-5H3/t16-,17?/m0/s1 |
| InChIKey | OEDSPHIILIMBRQ-BHWOMJMDSA-N |
| XLogP | 3.83 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|