C22H34NO7P — CID 53389736
1-O-benzyl 2-O-methyl (2S)-5-dibutoxyphosphorylpyrrolidine-1,2-dicarboxylate (PubChem CID 53389736) has the molecular formula C22H34NO7P and a molecular weight of 455.49 g/mol. Its IUPAC name is 1-O-benzyl 2-O-methyl (2S)-5-dibutoxyphosphorylpyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-methyl (2S)-5-dibutoxyphosphorylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 53389736 |
| Molecular Formula | C22H34NO7P |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 1-O-benzyl 2-O-methyl (2S)-5-dibutoxyphosphorylpyrrolidine-1,2-dicarboxylate |
| SMILES | CCCCOP(=O)(OCCCC)C1CC[C@@H](C(=O)OC)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H34NO7P/c1-4-6-15-29-31(26,30-16-7-5-2)20-14-13-19(21(24)27-3)23(20)22(25)28-17-18-11-9-8-10-12-18/h8-12,19-20H,4-7,13-17H2,1-3H3/t19-,20?/m0/s1 |
| InChIKey | URXLNJQYGWFHPQ-XJDOXCRVSA-N |
| XLogP | 5.11 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|